US9340510, 1.021

ID: ALA3984860

PubChem CID: 118940246

Max Phase: Preclinical

Molecular Formula: C23H30N2O2

Molecular Weight: 366.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)NC(C)c1ccc(CN2CCc3cc(OC(C)C)ccc3C2)cc1

Standard InChI:  InChI=1S/C23H30N2O2/c1-16(2)27-23-10-9-22-15-25(12-11-21(22)13-23)14-19-5-7-20(8-6-19)17(3)24-18(4)26/h5-10,13,16-17H,11-12,14-15H2,1-4H3,(H,24,26)

Standard InChI Key:  DOMNVXDWXMUHFS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    3.6331   -3.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7988    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0952    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0900   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7884   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3856   -1.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4280   -0.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3783   -3.0220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6739   -3.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6680   -4.9796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7162   -3.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26  8  1  0
 26 27  2  0
 27  5  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3984860

    ---

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.51Molecular Weight (Monoisotopic): 366.2307AlogP: 4.23#Rotatable Bonds: 6
Polar Surface Area: 41.57Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.88CX LogP: 3.66CX LogD: 3.05
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.83Np Likeness Score: -1.23

References

1.  (2016)  Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):