The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-(3-Chlorophenyl)-4,5-diphenyl-1H-imidazol-1-yl)methyl)-1H-1,2,3-triazol-1-yl)-N-(2,4-dimethylphenyl)acetamide ID: ALA3984954
PubChem CID: 134156711
Max Phase: Preclinical
Molecular Formula: C34H29ClN6O
Molecular Weight: 573.10
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2cc(Cn3c(-c4cccc(Cl)c4)nc(-c4ccccc4)c3-c3ccccc3)nn2)c(C)c1
Standard InChI: InChI=1S/C34H29ClN6O/c1-23-16-17-30(24(2)18-23)36-31(42)22-40-20-29(38-39-40)21-41-33(26-12-7-4-8-13-26)32(25-10-5-3-6-11-25)37-34(41)27-14-9-15-28(35)19-27/h3-20H,21-22H2,1-2H3,(H,36,42)
Standard InChI Key: MCUMWEGIOCLRNT-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
7.6128 -8.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4252 -8.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -8.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2672 -9.4755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4506 -9.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1063 -10.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2914 -10.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8212 -9.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1685 -8.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9853 -8.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0087 -9.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5731 -10.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 -7.9236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3525 -7.1940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9073 -6.6024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6462 -6.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -7.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0475 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8066 -4.4813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9760 -4.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7244 -5.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3789 -5.7317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9430 -5.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3435 -4.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5626 -5.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3807 -5.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9819 -6.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7610 -6.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5051 -3.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8358 -3.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3678 -2.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5506 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2057 -3.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6743 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8180 -5.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9752 -6.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7485 -6.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3640 -6.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2086 -5.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4377 -4.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9085 -7.3980 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
8 11 1 0
6 12 1 0
4 5 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
13 17 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
19 23 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
22 24 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
21 30 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
36 41 2 0
38 42 1 0
19 36 1 0
18 23 1 0
16 18 1 0
2 13 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.10Molecular Weight (Monoisotopic): 572.2091AlogP: 7.43#Rotatable Bonds: 8Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.69CX Basic pKa: 4.42CX LogP: 8.10CX LogD: 8.10Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.21Np Likeness Score: -1.84
References 1. Wang G, Peng Z, Wang J, Li J, Li X.. (2016) Synthesis and biological evaluation of novel 2,4,5-triarylimidazole-1,2,3-triazole derivatives via click chemistry as α-glucosidase inhibitors., 26 (23): [PMID:27810241 ] [10.1016/j.bmcl.2016.10.057 ] 2. Dhameja M, Gupta P.. (2019) Synthetic heterocyclic candidates as promising α-glucosidase inhibitors: An overview., 176 [PMID:31112894 ] [10.1016/j.ejmech.2019.04.025 ]