US9340517, 284

ID: ALA3984967

PubChem CID: 46896764

Max Phase: Preclinical

Molecular Formula: C34H40Cl2N4O2

Molecular Weight: 607.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC[C@@H]1CCN(CC(c2ccccc2)c2ccccc2)C(=O)[C@H](CCN2CCCCC2)N1)c1ccc(Cl)c(Cl)c1

Standard InChI:  InChI=1S/C34H40Cl2N4O2/c35-30-15-14-27(22-31(30)36)33(41)37-23-28-16-21-40(34(42)32(38-28)17-20-39-18-8-3-9-19-39)24-29(25-10-4-1-5-11-25)26-12-6-2-7-13-26/h1-2,4-7,10-15,22,28-29,32,38H,3,8-9,16-21,23-24H2,(H,37,41)/t28-,32-/m0/s1

Standard InChI Key:  LNVJJEVSOJBSKY-IUDBTDONSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  1  0  0  0  0  0999 V2000
    6.7170   -7.9463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.3673   -6.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3913   -5.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9541   -4.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4929   -3.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4688   -5.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9060   -6.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0868   -7.3364    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0525   -2.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8702   -1.6155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5900   -2.1568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1497   -0.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5245    2.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2987    3.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4702    4.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2467    5.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4194    6.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8158    6.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0393    4.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8666    3.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9007    4.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6725    5.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7255    6.0730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954    5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6672    3.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2692    3.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551   -0.6517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  5  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 13 12  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 18 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 16 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  1
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 36  1  0
 33 42  1  0
 42 13  1  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 607.63Molecular Weight (Monoisotopic): 606.2528AlogP: 5.99#Rotatable Bonds: 10
Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.03CX LogP: 5.61CX LogD: 3.98
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.30Np Likeness Score: -0.67

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):