amphidinolide B7

ID: ALA398497

PubChem CID: 21778009

Max Phase: Preclinical

Molecular Formula: C32H50O7

Molecular Weight: 546.75

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Amphidinolide B7 | Amphidinolide B4|amphidinolide B7|CHEMBL398497|(1S,2E,6E,10S,12R,13S,14R,17S,19S,20E,24R,26S)-13,14,17-Trihydroxy-7,10,12,19,20,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione

Canonical SMILES:  C=C1/C=C(\C)[C@@H](C)C[C@H](O)CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](C)OC(=O)/C(C)=C/CC/C=C/[C@@H]2O[C@H]2C[C@H](C)C1

Standard InChI:  InChI=1S/C32H50O7/c1-19-13-20(2)15-29-28(39-29)12-10-8-9-11-21(3)32(37)38-25(7)16-24(6)30(35)31(36)27(34)18-26(33)17-23(5)22(4)14-19/h10-12,14,20,23-26,28-31,33,35-36H,1,8-9,13,15-18H2,2-7H3/b12-10+,21-11+,22-14+/t20-,23+,24-,25+,26+,28+,29+,30+,31+/m1/s1

Standard InChI Key:  SHLAOTDGXARWIM-NMUCVDJPSA-N

Molfile:  

     RDKit          2D

 41 42  0  0  1  0  0  0  0  0999 V2000
    3.9291   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6436   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6436   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3581   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0725   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7870   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0725   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7870   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5015   -1.5750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0725   -3.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5015   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5015   -4.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2160   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2160   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2160   -5.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9304   -4.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5015   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5015   -6.5250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7870   -5.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7870   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0725   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3581   -5.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6436   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291   -5.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2147   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712   -5.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3568   -4.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857   -4.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2147   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2147   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5040   -6.1103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4958   -4.4500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1958   -6.2833    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  1  0
  8 10  1  6
 19 21  2  0
  4  5  1  0
 21 22  1  0
  8 11  1  0
 22 23  1  0
 23 24  1  0
 11 12  1  0
 24 25  2  0
 25 37  1  0
  5  6  1  0
 38 26  1  0
 11 13  1  6
 26 27  1  0
  2  3  1  6
 27 28  1  6
 12 14  1  0
 27 29  1  0
  5  7  2  0
 29 30  1  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 30 32  2  0
 14 16  1  6
 31 33  2  0
  6  8  1  0
 33 34  1  0
 15 17  1  0
 33 35  1  0
  2  4  1  0
 34 36  1  1
 38 37  1  0
 38 39  1  0
 37 39  1  0
 17 18  2  0
  6  9  1  6
 17 19  1  0
 37 40  1  1
  1 34  1  0
 38 41  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA398497

   AMPHIDINOLIDE B7

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 546.75

Molecular Weight (Monoisotopic): 546.3557

AlogP: 4.99

#Rotatable Bonds: ┄

Polar Surface Area: 116.59

Molecular Species: NEUTRAL

HBA: 7

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 7

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.41

CX Basic pKa: ┄

CX LogP: 5.43

CX LogD: 5.43

Aromatic Rings: ┄

Heavy Atoms: 39

QED Weighted: 0.22

Np Likeness Score: 2.70

References

1. Oguchi K, Tsuda M, Iwamoto R, Okamoto Y, Endo T, Kobayashi J, Ozawa T, Masuda A..  (2007)  Amphidinolides B6 and B7, cytotoxic macrolides from a symbiotic dinoflagellate Amphidinium species.,  70  (10): [PMID:17922551] [10.1021/np0703085]

Source

Source(1):

• Scientific Literature