US9255090, 174

ID: ALA3985005

PubChem CID: 89649012

Max Phase: Preclinical

Molecular Formula: C27H26FNO5

Molecular Weight: 463.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CCCOc1ccc(F)cc1-c1cccc2c1CN(C(=O)OCc1ccccc1)CC2

Standard InChI:  InChI=1S/C27H26FNO5/c28-21-11-12-25(33-15-5-10-26(30)31)23(16-21)22-9-4-8-20-13-14-29(17-24(20)22)27(32)34-18-19-6-2-1-3-7-19/h1-4,6-9,11-12,16H,5,10,13-15,17-18H2,(H,30,31)

Standard InChI Key:  FZVXCDVZDYPTHX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    5.4825    5.8464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5197    5.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5608    5.8397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5142    3.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2121    2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2066    1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046    0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8924   -4.9525    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2959   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3341   -5.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049   -5.9994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3088   -8.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3141   -9.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6157  -10.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9122   -9.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9070   -8.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6053   -7.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  2  0
 14  8  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 15  1  0
 24 19  2  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.51Molecular Weight (Monoisotopic): 463.1795AlogP: 5.43#Rotatable Bonds: 8
Polar Surface Area: 76.07Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.13CX Basic pKa: CX LogP: 5.16CX LogD: 2.08
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -0.61

References

1.  (2016)  Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):