The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8999981, A109 ID: ALA3985036
PubChem CID: 91970547
Max Phase: Preclinical
Molecular Formula: C25H36F2N6O2
Molecular Weight: 490.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C.CCCCN1CCN(C(=O)N2Cc3c(NC(=O)c4ccc(F)cc4F)n[nH]c3C2(C)C)[C@@H](C)C1
Standard InChI: InChI=1S/C24H32F2N6O2.CH4/c1-5-6-9-30-10-11-31(15(2)13-30)23(34)32-14-18-20(24(32,3)4)28-29-21(18)27-22(33)17-8-7-16(25)12-19(17)26;/h7-8,12,15H,5-6,9-11,13-14H2,1-4H3,(H2,27,28,29,33);1H4/t15-;/m0./s1
Standard InChI Key: UEODRIQYYJVRHP-RSAXXLAASA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
10.6848 -3.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9775 -2.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4851 -2.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6005 -1.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1081 -1.7595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2222 -0.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7310 -0.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1255 -2.0835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0115 -3.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5273 -4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5028 -3.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6332 -2.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1470 -3.3397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4164 3.9144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1953 5.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3889 5.4088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6849 6.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1767 6.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0589 7.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4494 8.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1552 9.8973 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9577 9.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0755 7.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1179 7.9971 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9414 -0.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2457 -2.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3622 2.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 6
9 11 1 0
11 5 1 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
17 29 2 0
29 30 1 0
30 31 1 0
31 16 2 0
31 32 1 0
32 14 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.60Molecular Weight (Monoisotopic): 490.2868AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. (2015) 3-amido-pyrrolo[3,4-C]pyrazole-5(1H, 4H,6H) carbaldehyde derivatives,