US9173884, BC11-28-5

ID: ALA3985042

PubChem CID: 1522620

Max Phase: Preclinical

Molecular Formula: C24H18N4

Molecular Weight: 362.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(Nc2ncnc3c2c(-c2ccccc2)cn3-c2ccccc2)cc1

Standard InChI:  InChI=1S/C24H18N4/c1-4-10-18(11-5-1)21-16-28(20-14-8-3-9-15-20)24-22(21)23(25-17-26-24)27-19-12-6-2-7-13-19/h1-17H,(H,25,26,27)

Standard InChI Key:  VBOCODNKKAPBAW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8813   -1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9619   -2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4014   -2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7561   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6713    0.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2318    0.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6929   -4.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1743   -3.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0913   -5.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5218   -6.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0353   -6.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1183   -5.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  1  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

Associated Targets(Human)

PDE11A Tchem Phosphodiesterase 11A (449 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.44Molecular Weight (Monoisotopic): 362.1531AlogP: 5.83#Rotatable Bonds: 4
Polar Surface Area: 42.74Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 6.08CX LogD: 6.08
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: -1.16

References

1.  (2015)  Inhibitors of phosphodiesterase 11 (PDE11), 

Source

Source(1):