The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9247759, 10-70 ID: ALA3985068
PubChem CID: 57422486
Max Phase: Preclinical
Molecular Formula: C25H24N6O3
Molecular Weight: 456.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(C)c1Cn1cc(-n2c(=O)n(Cc3ccccc3)n(Cc3ccccc3)c2=O)cn1
Standard InChI: InChI=1S/C25H24N6O3/c1-18-23(19(2)34-27-18)17-28-16-22(13-26-28)31-24(32)29(14-20-9-5-3-6-10-20)30(25(31)33)15-21-11-7-4-8-12-21/h3-13,16H,14-15,17H2,1-2H3
Standard InChI Key: SLFMGTQCTQWWNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
5.3347 -10.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5118 -11.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1484 -12.5039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6369 -12.3181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9201 -10.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0036 -10.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6095 -10.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4205 -8.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0394 -8.0726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6940 -6.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2151 -6.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6205 -7.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7579 -8.8522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9460 -3.4943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0420 -3.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1671 -4.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5901 -3.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7125 -4.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4119 -6.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9889 -6.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8665 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1285 -6.2561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
5 7 1 0
7 2 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
11 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
25 33 1 0
33 14 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.51Molecular Weight (Monoisotopic): 456.1910AlogP: 2.75#Rotatable Bonds: 7Polar Surface Area: 92.78Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.66CX LogP: 3.36CX LogD: 3.36Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.31
References 1. (2016) Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof,