US9247759, 10-70

ID: ALA3985068

PubChem CID: 57422486

Max Phase: Preclinical

Molecular Formula: C25H24N6O3

Molecular Weight: 456.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1Cn1cc(-n2c(=O)n(Cc3ccccc3)n(Cc3ccccc3)c2=O)cn1

Standard InChI:  InChI=1S/C25H24N6O3/c1-18-23(19(2)34-27-18)17-28-16-22(13-26-28)31-24(32)29(14-20-9-5-3-6-10-20)30(25(31)33)15-21-11-7-4-8-12-21/h3-13,16H,14-15,17H2,1-2H3

Standard InChI Key:  SLFMGTQCTQWWNG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    5.3347  -10.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5118  -11.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1484  -12.5039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369  -12.3181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9201  -10.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0036  -10.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6095  -10.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4205   -8.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0394   -8.0726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6940   -6.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2151   -6.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6205   -7.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7579   -8.8522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9460   -3.4943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0420   -3.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1671   -4.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5901   -3.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7125   -4.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4119   -6.3673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9889   -6.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8665   -5.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1285   -6.2561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  5  7  1  0
  7  2  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 33  1  0
 33 14  1  0
 33 34  2  0
M  END

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.51Molecular Weight (Monoisotopic): 456.1910AlogP: 2.75#Rotatable Bonds: 7
Polar Surface Area: 92.78Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.66CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.31

References

1.  (2016)  Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof, 

Source

Source(1):