US9340517, 221

ID: ALA3985127

PubChem CID: 46896461

Max Phase: Preclinical

Molecular Formula: C34H37FN4O2

Molecular Weight: 552.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCC[C@@H]1N[C@H](CNC(=O)c2ccc3cc(F)ccc3c2)CCN(CC(c2ccccc2)c2ccccc2)C1=O

Standard InChI:  InChI=1S/C34H37FN4O2/c35-29-16-15-26-20-28(14-13-27(26)21-29)33(40)37-22-30-17-19-39(34(41)32(38-30)12-7-18-36)23-31(24-8-3-1-4-9-24)25-10-5-2-6-11-25/h1-6,8-11,13-16,20-21,30-32,38H,7,12,17-19,22-23,36H2,(H,37,40)/t30-,32-/m0/s1

Standard InChI Key:  SBIOEJXYDUVYQR-CDZUIXILSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
   -2.5607   -6.0454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7488   -6.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2838   -6.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7317   -7.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1986   -7.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5374   -5.9206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9364    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2403   -5.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5691   -7.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6298   -8.5630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2799   -9.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7763  -10.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4256  -11.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9211  -11.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5673  -12.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7180  -14.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2226  -13.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5764  -12.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6239   -8.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1197   -8.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9651   -7.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3148   -6.3163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8190   -6.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9736   -7.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1298   -8.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6054   -9.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  6
  5  6  1  0
  6  7  1  0
  7  8  1  6
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 15  1  0
 21 22  2  0
 22 12  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 25 40  1  0
 40  5  1  0
 40 41  2  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.69Molecular Weight (Monoisotopic): 552.2901AlogP: 4.84#Rotatable Bonds: 10
Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.90CX LogP: 4.39CX LogD: 1.67
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -0.37

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):