US9150577, 2

ID: ALA3985216

PubChem CID: 68323371

Max Phase: Preclinical

Molecular Formula: C17H16N4O3

Molecular Weight: 324.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)c2ccc3cc4n(c3c2)CCCNC4=O)no1

Standard InChI:  InChI=1S/C17H16N4O3/c1-10-7-15(20-24-10)19-16(22)12-4-3-11-8-14-17(23)18-5-2-6-21(14)13(11)9-12/h3-4,7-9H,2,5-6H2,1H3,(H,18,23)(H,19,20,22)

Standard InChI Key:  KEZBZQRURZGVHI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    0.6481  -12.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2097  -11.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2421  -10.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3318   -9.1403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0590   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4396   -7.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8869   -6.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7403   -7.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675   -5.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7135   -4.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0908   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0226   -2.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2896    1.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5767   -2.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1989   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0172   -9.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 14  1  0
 21 22  1  0
 22 12  1  0
 22 23  2  0
 23  9  1  0
  5 24  1  0
 24  2  2  0
M  END

Associated Targets(Human)

RPS6KA2 Tchem Ribosomal protein S6 kinase alpha 2 (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.34Molecular Weight (Monoisotopic): 324.1222AlogP: 2.32#Rotatable Bonds: 2
Polar Surface Area: 89.16Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.76CX Basic pKa: CX LogP: 1.43CX LogD: 1.43
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.76Np Likeness Score: -1.48

References

1.  (2015)  Heterocyclic compounds containing an indole core, 

Source

Source(1):