US9242982, 1k

ID: ALA3985226

PubChem CID: 76955637

Max Phase: Preclinical

Molecular Formula: C16H14BrN3O3

Molecular Weight: 376.21

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(=O)c2cc(Cc3ccc(Br)cc3)c(=O)[nH]c2n(C)c1=O

Standard InChI:  InChI=1S/C16H14BrN3O3/c1-19-13-12(15(22)20(2)16(19)23)8-10(14(21)18-13)7-9-3-5-11(17)6-4-9/h3-6,8H,7H2,1-2H3,(H,18,21)

Standard InChI Key:  HPPSOCPIWHTPFM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1953   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1932   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4896   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4844   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1828   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1786   -7.2040    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8863   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8915   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9364    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 18 12  1  0
 10 19  1  0
 19 20  2  0
 19 21  1  0
 21  7  1  0
  8 22  1  0
 22  2  1  0
 22 23  2  0
M  END

Associated Targets(Human)

PDE3A Tclin Phosphodiesterase 3 (1749 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.21Molecular Weight (Monoisotopic): 375.0219AlogP: 1.28#Rotatable Bonds: 2
Polar Surface Area: 76.86Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.88CX Basic pKa: CX LogP: 1.84CX LogD: 1.83
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.73Np Likeness Score: -0.70

References

1.  (2016)  Pyridopyrimidine based derivatives as potential phosphodiesterase 3 (PDE3) inhibitors and a process for the preparation thereof, 

Source

Source(1):