US9340517, 350

ID: ALA3985356

PubChem CID: 127054175

Max Phase: Preclinical

Molecular Formula: C30H44N4O2

Molecular Weight: 492.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(CC)CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2)N[C@H](CCN2CCCCC2)C1=O

Standard InChI:  InChI=1S/C30H44N4O2/c1-3-23(4-2)22-34-19-14-27(32-28(30(34)36)15-18-33-16-8-5-9-17-33)21-31-29(35)26-13-12-24-10-6-7-11-25(24)20-26/h6-7,10-13,20,23,27-28,32H,3-5,8-9,14-19,21-22H2,1-2H3,(H,31,35)/t27-,28-/m1/s1

Standard InChI Key:  DTOOUBDUVXWTKR-VSGBNLITSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
   -0.8824  -11.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3146  -11.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9732  -10.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1367   -8.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6645   -7.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4704   -9.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1298   -8.5578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1986   -7.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5374   -5.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2403   -5.9299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5691   -7.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0337   -7.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0567   -6.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5195   -6.9678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5436   -5.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0048   -6.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4420   -7.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4180   -8.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9568   -8.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6298   -8.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1467   -9.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  1  0
 23 24  2  0
 24 15  1  0
 10 25  1  0
 25 26  1  0
 26 27  1  6
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 29  1  0
 26 35  1  0
 35  7  1  0
 35 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3985356

    ---

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.71Molecular Weight (Monoisotopic): 492.3464AlogP: 4.44#Rotatable Bonds: 10
Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.03CX LogP: 4.01CX LogD: 2.38
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -0.40

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):