The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 350 ID: ALA3985356
PubChem CID: 127054175
Max Phase: Preclinical
Molecular Formula: C30H44N4O2
Molecular Weight: 492.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2)N[C@H](CCN2CCCCC2)C1=O
Standard InChI: InChI=1S/C30H44N4O2/c1-3-23(4-2)22-34-19-14-27(32-28(30(34)36)15-18-33-16-8-5-9-17-33)21-31-29(35)26-13-12-24-10-6-7-11-25(24)20-26/h6-7,10-13,20,23,27-28,32H,3-5,8-9,14-19,21-22H2,1-2H3,(H,31,35)/t27-,28-/m1/s1
Standard InChI Key: DTOOUBDUVXWTKR-VSGBNLITSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
-0.8824 -11.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3146 -11.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9732 -10.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1367 -8.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6645 -7.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4704 -9.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1298 -8.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1986 -7.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5374 -5.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2403 -5.9299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5691 -7.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0337 -7.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0567 -6.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5195 -6.9678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5436 -5.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0048 -6.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4420 -7.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4180 -8.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9568 -8.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6298 -8.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1467 -9.6459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 6
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 1 0
23 24 2 0
24 15 1 0
10 25 1 0
25 26 1 0
26 27 1 6
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 29 1 0
26 35 1 0
35 7 1 0
35 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.71Molecular Weight (Monoisotopic): 492.3464AlogP: 4.44#Rotatable Bonds: 10Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.03CX LogP: 4.01CX LogD: 2.38Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -0.40
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,