US9266877, 176

ID: ALA3985366

PubChem CID: 89498266

Max Phase: Preclinical

Molecular Formula: C38H39N7O3S

Molecular Weight: 673.84

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(-c2ccc(N3CCc4cccc(C(=O)Nc5nc6ccccc6s5)c4C3)nc2C(=O)O)cc(C#N)n1CC1(N(C)C)CCCCC1

Standard InChI:  InChI=1S/C38H39N7O3S/c1-24-29(20-26(21-39)45(24)23-38(43(2)3)17-7-4-8-18-38)27-14-15-33(41-34(27)36(47)48)44-19-16-25-10-9-11-28(30(25)22-44)35(46)42-37-40-31-12-5-6-13-32(31)49-37/h5-6,9-15,20H,4,7-8,16-19,22-23H2,1-3H3,(H,47,48)(H,40,42,46)

Standard InChI Key:  GTQOBRXIUSEPME-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 49 55  0  0  0  0  0  0  0  0999 V2000
   11.2984   -7.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5979   -6.6964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4039   -6.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2142   -5.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3374   -4.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8466   -4.2581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8464   -3.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0926   -1.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4930   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6262   -5.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0924   -5.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6975   -6.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1821   -8.0232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8478   -5.8502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9261   -5.8568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6011   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5630   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9020   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9050   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1186   -6.1101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6550   -7.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4050   -8.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6550  -10.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1550  -10.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4050   -8.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1550   -7.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6915   -6.1101    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0490   -6.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5414   -6.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1576   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2814   -3.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7889   -3.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  3  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 17 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 41 42  1  0
 42 34  1  0
 30 43  2  0
 43 26  1  0
 43 44  1  0
 44 23  1  0
  4 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 49  1  0
 49  4  1  0
M  END

Associated Targets(Human)

BCL2L1 Tchem Apoptosis regulator Bcl-X (2604 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Bcl2l1 Bcl-2-like protein 1 (598 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 673.84Molecular Weight (Monoisotopic): 673.2835AlogP: 7.12#Rotatable Bonds: 8
Polar Surface Area: 127.38Molecular Species: ZWITTERIONHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.52CX Basic pKa: 9.96CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 5Heavy Atoms: 49QED Weighted: 0.18Np Likeness Score: -1.36

References

1.  (2016)  Apoptosis-inducing agents for the treatment of cancer and immune and autoimmune diseases, 

Source

Source(1):