The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9247759, 12-21 ID: ALA3985403
PubChem CID: 53375153
Max Phase: Preclinical
Molecular Formula: C20H24N6O4
Molecular Weight: 412.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(C)c1CN1C(=O)N(c2cnn(Cc3c(C)noc3C)c2)C(=O)C1(C)C
Standard InChI: InChI=1S/C20H24N6O4/c1-11-16(13(3)29-22-11)9-24-8-15(7-21-24)26-18(27)20(5,6)25(19(26)28)10-17-12(2)23-30-14(17)4/h7-8H,9-10H2,1-6H3
Standard InChI Key: SWWMNTHYUKOJAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.4553 -2.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3548 0.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0157 -3.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4437 -3.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3278 -3.0919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6057 -5.3944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7625 -6.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0079 -7.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7701 -4.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4589 -3.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2451 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9080 -6.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2973 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2149 -6.8096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3699 -8.0489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8723 -9.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9002 -10.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2649 -12.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3764 -12.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9861 -12.8298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8453 -11.8559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4190 -10.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7979 -9.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9301 -7.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
5 7 1 0
7 2 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 9 1 0
15 16 1 0
15 17 1 0
12 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
21 30 1 0
30 18 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.45Molecular Weight (Monoisotopic): 412.1859AlogP: 2.89#Rotatable Bonds: 5Polar Surface Area: 110.50Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.89CX LogP: 0.92CX LogD: 0.92Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.30
References 1. (2016) Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof,