US9247759, 12-21

ID: ALA3985403

PubChem CID: 53375153

Max Phase: Preclinical

Molecular Formula: C20H24N6O4

Molecular Weight: 412.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1CN1C(=O)N(c2cnn(Cc3c(C)noc3C)c2)C(=O)C1(C)C

Standard InChI:  InChI=1S/C20H24N6O4/c1-11-16(13(3)29-22-11)9-24-8-15(7-21-24)26-18(27)20(5,6)25(19(26)28)10-17-12(2)23-30-14(17)4/h7-8H,9-10H2,1-6H3

Standard InChI Key:  SWWMNTHYUKOJAT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.4553   -2.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3548    0.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6281   -2.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0157   -3.6164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4437   -3.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3278   -3.0919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6057   -5.3944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -6.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0079   -7.1840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7701   -4.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4589   -3.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2451   -6.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9080   -6.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2973   -5.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2149   -6.8096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3699   -8.0489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8723   -9.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9002  -10.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2649  -12.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3764  -12.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9861  -12.8298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8453  -11.8559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4190  -10.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7979   -9.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9301   -7.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  5  7  1  0
  7  2  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15  9  1  0
 15 16  1  0
 15 17  1  0
 12 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 28 29  1  0
 21 30  1  0
 30 18  2  0
M  END

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.45Molecular Weight (Monoisotopic): 412.1859AlogP: 2.89#Rotatable Bonds: 5
Polar Surface Area: 110.50Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.89CX LogP: 0.92CX LogD: 0.92
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.30

References

1.  (2016)  Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof, 

Source

Source(1):