The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N1-hydroxy-2-isobutyl-N3-((R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl)-2-(2-(thiophen-2-ylthio)ethyl)malonamide ID: ALA3985409
PubChem CID: 58619812
Max Phase: Preclinical
Molecular Formula: C23H31N3O4S2
Molecular Weight: 477.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@](CCSc1cccs1)(CC(C)C)C(=O)NO
Standard InChI: InChI=1S/C23H31N3O4S2/c1-16(2)15-23(22(29)26-30,11-13-32-19-10-7-12-31-19)21(28)25-18(20(27)24-3)14-17-8-5-4-6-9-17/h4-10,12,16,18,30H,11,13-15H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)/t18-,23-/m1/s1
Standard InChI Key: QKBBCSLYMZPVMT-WZONZLPQSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
11.9207 -8.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6352 -7.6415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2063 -7.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9207 -8.8790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3496 -8.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0641 -7.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3496 -8.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6352 -9.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0641 -9.2915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0641 -10.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0641 -6.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7818 -6.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7821 -5.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0671 -5.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3502 -5.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3535 -6.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4918 -8.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2063 -6.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4874 -7.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9207 -6.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9207 -5.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7124 -6.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6999 -6.4291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7708 -6.8165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7773 -7.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0629 -8.0540 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0629 -8.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3985 -9.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6535 -10.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4785 -10.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7333 -9.3674 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0500 -7.2340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 6
5 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
6 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
3 17 1 0
3 18 1 1
3 19 1 0
18 20 1 0
20 21 1 0
20 22 1 0
19 23 2 0
19 24 1 0
17 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
24 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.65Molecular Weight (Monoisotopic): 477.1756AlogP: 3.24#Rotatable Bonds: 12Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.75CX Basic pKa: ┄CX LogP: 3.64CX LogD: 3.62Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.49
References 1. (2001) Selective inhibitors of aggrecanase in osteoarthritis treatment,