(S)-N1-hydroxy-2-isobutyl-N3-((R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl)-2-(2-(thiophen-2-ylthio)ethyl)malonamide

ID: ALA3985409

PubChem CID: 58619812

Max Phase: Preclinical

Molecular Formula: C23H31N3O4S2

Molecular Weight: 477.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@](CCSc1cccs1)(CC(C)C)C(=O)NO

Standard InChI:  InChI=1S/C23H31N3O4S2/c1-16(2)15-23(22(29)26-30,11-13-32-19-10-7-12-31-19)21(28)25-18(20(27)24-3)14-17-8-5-4-6-9-17/h4-10,12,16,18,30H,11,13-15H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)/t18-,23-/m1/s1

Standard InChI Key:  QKBBCSLYMZPVMT-WZONZLPQSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   11.9207   -8.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6352   -7.6415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2063   -7.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9207   -8.8790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3496   -8.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0641   -7.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3496   -8.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6352   -9.2915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0641   -9.2915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0641  -10.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0641   -6.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7818   -6.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7821   -5.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0671   -5.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3502   -5.5868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3535   -6.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4918   -8.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2063   -6.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4874   -7.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9207   -6.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9207   -5.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7124   -6.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6999   -6.4291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7708   -6.8165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7773   -7.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0629   -8.0540    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0629   -8.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3985   -9.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6535  -10.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4785  -10.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7333   -9.3674    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0500   -7.2340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  6
  5  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  6 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 17  1  0
  3 18  1  1
  3 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
 19 23  2  0
 19 24  1  0
 17 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
 24 32  1  0
M  END

Associated Targets(non-human)

ADAMTS4 Aggrecanase (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.65Molecular Weight (Monoisotopic): 477.1756AlogP: 3.24#Rotatable Bonds: 12
Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 8.75CX Basic pKa: CX LogP: 3.64CX LogD: 3.62
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.49

References

1.  (2001)  Selective inhibitors of aggrecanase in osteoarthritis treatment, 

Source