The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9150544, 62 ID: ALA3985466
PubChem CID: 71626339
Max Phase: Preclinical
Molecular Formula: C23H25ClN6O5S
Molecular Weight: 533.01
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(S(=O)(=O)N[C@H]2CCN([C@H](Cc3cc4ccnc(N)c4cc3Cl)C(=O)O)C2=O)cn1
Standard InChI: InChI=1S/C23H25ClN6O5S/c1-29(2)20-4-3-15(12-27-20)36(34,35)28-18-6-8-30(22(18)31)19(23(32)33)10-14-9-13-5-7-26-21(25)16(13)11-17(14)24/h3-5,7,9,11-12,18-19,28H,6,8,10H2,1-2H3,(H2,25,26)(H,32,33)/t18-,19+/m0/s1
Standard InChI Key: ORPCYBIXIFWZDJ-RBUKOAKNSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
16.3847 -1.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8959 -2.4307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6010 -3.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4033 -2.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7904 -3.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2983 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4191 -2.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0321 -1.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5242 -1.3722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9262 -3.0488 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.4362 -4.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7326 -3.1723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0458 -1.8334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6373 0.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.8995 0.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9385 1.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8603 1.3554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7942 0.3031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
10 12 2 0
10 13 1 0
14 13 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 6
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
26 28 2 0
28 22 1 0
28 29 1 0
29 30 2 0
30 20 1 0
30 31 1 0
18 32 1 0
32 33 2 0
32 34 1 0
17 35 1 0
35 14 1 0
35 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.01Molecular Weight (Monoisotopic): 532.1296AlogP: 1.51#Rotatable Bonds: 8Polar Surface Area: 158.82Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.02CX Basic pKa: 6.15CX LogP: -0.37CX LogD: -1.51Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.02
References 1. (2015) Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application,