The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, X20, Table 37A, Compound 24 ID: ALA3985479
PubChem CID: 137316510
Max Phase: Preclinical
Molecular Formula: C21H27N9O3
Molecular Weight: 453.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2cnn3c(NC4CC4)nc(NCC4(CN5CCOCC5)CC4)nc23)N1
Standard InChI: InChI=1S/C21H27N9O3/c31-17-15(25-20(32)27-17)9-13-10-23-30-16(13)26-18(28-19(30)24-14-1-2-14)22-11-21(3-4-21)12-29-5-7-33-8-6-29/h9-10,14H,1-8,11-12H2,(H2,22,24,26,28)(H2,25,27,31,32)/b15-9-
Standard InChI Key: LDSYBLNRDRBJID-DHDCSXOGSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
2.1760 -8.1488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2028 -7.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2222 -7.9149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1079 -6.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3079 -6.7011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3408 4.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8408 4.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4991 0.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8006 1.4876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 0.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3988 1.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3993 2.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1005 3.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8012 2.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9525 2.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4525 2.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1979 -5.9466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 14 1 0
12 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
21 29 1 0
29 30 1 0
30 21 1 0
18 31 2 0
31 32 1 0
32 8 2 0
32 11 1 0
6 33 1 0
33 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.51Molecular Weight (Monoisotopic): 453.2237AlogP: 0.40#Rotatable Bonds: 8Polar Surface Area: 137.81Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.24CX Basic pKa: 6.72CX LogP: -0.62CX LogD: -0.68Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.03
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,