3-{3-[(1E)-2-(4-Methylphenyl)Vinyl]-1H-Indazol-5-yl}-1H-1,2,4-Triazole

ID: ALA3985482

PubChem CID: 22480325

Max Phase: Preclinical

Molecular Formula: C18H15N5

Molecular Weight: 301.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(/C=C/c2n[nH]c3ccc(-c4nnc[nH]4)cc23)cc1

Standard InChI:  InChI=1S/C18H15N5/c1-12-2-4-13(5-3-12)6-8-16-15-10-14(18-19-11-20-23-18)7-9-17(15)22-21-16/h2-11H,1H3,(H,21,22)(H,19,20,23)/b8-6+

Standard InChI Key:  ZJSHQKYVPYSBJO-SOFGYWHQSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   35.5072   -6.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5056   -7.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2166   -7.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2139   -6.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9238   -6.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9270   -7.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7137   -7.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1924   -7.0097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.7061   -6.3471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9713   -8.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8000   -7.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0530   -7.5165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5070   -8.1245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9166   -8.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7157   -8.6606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4242   -9.0685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6774   -9.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1298  -10.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3824  -11.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1827  -11.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7298  -10.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4743  -10.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4369  -12.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  7 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  2 11  1  0
 10 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
M  END

Associated Targets(Human)

MAPK9 Tchem c-Jun N-terminal kinase 2 (4655 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 301.35Molecular Weight (Monoisotopic): 301.1327AlogP: 3.83#Rotatable Bonds: 3
Polar Surface Area: 70.25Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.93CX Basic pKa: 2.57CX LogP: 3.33CX LogD: 3.33
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.60Np Likeness Score: -0.90

References

1.  (2002)  Indazole derivatives as JNK inhibitors and compositions and methods related thereto, 

Source