US9255090, 219

ID: ALA3985541

PubChem CID: 89649510

Max Phase: Preclinical

Molecular Formula: C30H30FNO4

Molecular Weight: 487.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(CC(=O)O)cc1-c1ccc(F)c2c1CN(C(=O)CC1CCc3ccccc31)CC2

Standard InChI:  InChI=1S/C30H30FNO4/c1-2-36-28-12-7-19(16-30(34)35)15-25(28)23-10-11-27(31)24-13-14-32(18-26(23)24)29(33)17-21-9-8-20-5-3-4-6-22(20)21/h3-7,10-12,15,21H,2,8-9,13-14,16-18H2,1H3,(H,34,35)

Standard InChI Key:  NYEIHILLRCVIGH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    5.2110    2.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2066    1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046    0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5825   -7.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496   -5.3964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2959   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3341   -5.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049   -5.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2054   -8.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7416   -9.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7576   -9.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7615  -10.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2287  -10.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6919   -9.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6881   -8.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2209   -8.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  7 12  1  0
 12 13  2  0
 13  4  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 14  1  0
 24 19  2  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 28  1  0
 36 31  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.57Molecular Weight (Monoisotopic): 487.2159AlogP: 5.52#Rotatable Bonds: 7
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.25CX Basic pKa: CX LogP: 5.42CX LogD: 2.43
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.48Np Likeness Score: -0.59

References

1.  (2016)  Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):