The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(5-(1H-1,2,4-Triazol-3-yl)(1H-Indazol-3-yl))Phenyl]-3-Propanamide ID: ALA3985543
PubChem CID: 58847576
Max Phase: Preclinical
Molecular Formula: C24H20N6O
Molecular Weight: 408.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCc1ccccc1)Nc1cccc(-c2n[nH]c3ccc(-c4nc[nH]n4)cc23)c1
Standard InChI: InChI=1S/C24H20N6O/c31-22(12-9-16-5-2-1-3-6-16)27-19-8-4-7-17(13-19)23-20-14-18(24-25-15-26-30-24)10-11-21(20)28-29-23/h1-8,10-11,13-15H,9,12H2,(H,27,31)(H,28,29)(H,25,26,30)
Standard InChI Key: IIFMFEINOPYOOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
3.9298 -7.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9282 -8.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6392 -8.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6365 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3464 -7.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3495 -8.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1363 -8.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6150 -7.6081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1287 -6.9456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3939 -9.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8467 -9.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1038 -10.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9080 -10.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4547 -9.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1948 -9.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2226 -8.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2555 -10.1579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7970 -9.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5377 -8.7709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4780 -8.1205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9339 -8.7293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3449 -9.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1428 -9.2621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5978 -9.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1324 -9.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9275 -9.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1849 -10.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9792 -10.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5157 -9.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2523 -8.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4586 -8.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 1 0
14 17 1 0
17 18 1 0
18 19 2 0
16 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 16 1 0
18 24 1 0
25 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.47Molecular Weight (Monoisotopic): 408.1699AlogP: 4.59#Rotatable Bonds: 6Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.51CX Basic pKa: 1.90CX LogP: 4.97CX LogD: 4.97Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.54
References 1. (2002) Indazole derivatives as JNK inhibitors and compositions and methods related thereto,