The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, V30, Table 37A, Compound 281 ID: ALA3985559
PubChem CID: 136483991
Max Phase: Preclinical
Molecular Formula: C20H19ClN8O3
Molecular Weight: 454.88
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2cnn3c(NC4CC4)nc(NCCOc4cccc(Cl)c4)nc23)N1
Standard InChI: InChI=1S/C20H19ClN8O3/c21-12-2-1-3-14(9-12)32-7-6-22-18-26-16-11(8-15-17(30)27-20(31)25-15)10-23-29(16)19(28-18)24-13-4-5-13/h1-3,8-10,13H,4-7H2,(H2,22,24,26,28)(H2,25,27,30,31)/b15-8-
Standard InChI Key: BQCBGRPRQUYQMC-NVNXTCNLSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
8.8268 -5.4110 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -6.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7875 -7.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -8.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1895 -7.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 15 1 0
13 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 23 1 0
28 29 2 0
21 30 2 0
30 18 1 0
30 31 1 0
31 11 2 0
6 32 2 0
32 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.88Molecular Weight (Monoisotopic): 454.1269AlogP: 2.02#Rotatable Bonds: 8Polar Surface Area: 134.57Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.24CX Basic pKa: 2.34CX LogP: 1.69CX LogD: 1.31Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.23Np Likeness Score: -1.45
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,