N,N2,N2-Trimethyl-N-{[4'-(morpholin-4-yl)biphenyl-3-yl]methyl}glycinamide (2R,3R)-tartrate

ID: ALA3985575

PubChem CID: 134157682

Max Phase: Preclinical

Molecular Formula: C26H35N3O8

Molecular Weight: 367.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CC(=O)N(C)Cc1cccc(-c2ccc(N3CCOCC3)cc2)c1.O=C(O)[C@H](O)[C@@H](O)C(=O)O

Standard InChI:  InChI=1S/C22H29N3O2.C4H6O6/c1-23(2)17-22(26)24(3)16-18-5-4-6-20(15-18)19-7-9-21(10-8-19)25-11-13-27-14-12-25;5-1(3(7)8)2(6)4(9)10/h4-10,15H,11-14,16-17H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1

Standard InChI Key:  ISHQPYYRBDVSQB-LREBCSMRSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   15.8492   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5581   -3.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2669   -5.9437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5581   -4.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2669   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9758   -4.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8492   -5.9437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1403   -4.7159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9758   -3.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6847   -5.1252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0456   -1.7744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7545   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0456   -0.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3368   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2101   -1.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9190   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6279   -1.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6279   -0.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9190   -0.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2101   -0.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5012   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7923   -1.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0835   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0835   -3.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7923   -3.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5012   -3.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7545   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4622   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1699   -2.1836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3786   -3.4095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6711   -2.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9655   -3.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9613   -4.2214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6688   -4.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3806   -4.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8776   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1699   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  1  0
  4  2  1  6
  4  5  1  0
  5  3  1  6
  5  6  1  0
  1  7  2  0
  1  8  1  0
  6  9  2  0
  6 10  1  0
 11 12  1  0
 11 13  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 15 20  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 15 21  1  0
 14 17  1  0
 11 14  1  0
 12 27  2  0
 12 28  1  0
 28 29  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 24 30  1  0
 29 36  1  0
 29 37  1  0
M  END

Associated Targets(Human)

AOC3 Tchem Amine oxidase, copper containing (450 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.49Molecular Weight (Monoisotopic): 367.2260AlogP: 2.71#Rotatable Bonds: 6
Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.50CX LogP: 2.57CX LogD: 2.22
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.79Np Likeness Score: -1.62

References

1. Yamaki S, Suzuki D, Fujiyasu J, Neya M, Nagashima A, Kondo M, Akabane T, Kadono K, Moritomo A, Yoshihara K..  (2017)  Synthesis and structure activity relationships of glycine amide derivatives as novel Vascular Adhesion Protein-1 inhibitors.,  25  (1): [PMID:27810440] [10.1016/j.bmc.2016.10.025]

Source