The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 493 ID: ALA3985611
PubChem CID: 46897442
Max Phase: Preclinical
Molecular Formula: C31H39ClN4O2
Molecular Weight: 535.13
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](CN1CC[C@H](CNC(=O)c2ccc3cc(Cl)ccc3c2)N[C@H](CC(C)(C)N)C1=O)c1ccccc1
Standard InChI: InChI=1S/C31H39ClN4O2/c1-4-21(22-8-6-5-7-9-22)20-36-15-14-27(35-28(30(36)38)18-31(2,3)33)19-34-29(37)25-11-10-24-17-26(32)13-12-23(24)16-25/h5-13,16-17,21,27-28,35H,4,14-15,18-20,33H2,1-3H3,(H,34,37)/t21-,27-,28-/m1/s1
Standard InChI Key: JCQMVGHNRJRBCG-KPGYKUMBSA-N
Molfile:
RDKit 2D
38 41 0 0 1 0 0 0 0 0999 V2000
0.6645 -7.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1367 -8.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9732 -10.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4704 -9.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1298 -8.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1986 -7.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5374 -5.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9364 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2403 -5.9299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5691 -7.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0337 -7.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0567 -6.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7050 -5.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8743 -5.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2263 -6.9004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6298 -8.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1467 -9.6459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3146 -11.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1816 -11.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8371 -12.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9964 -14.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4998 -13.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1553 -12.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 6
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 16 1 0
22 23 2 0
23 13 1 0
8 24 1 0
24 25 1 0
25 26 1 6
26 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
25 31 1 0
31 5 1 0
31 32 2 0
3 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.13Molecular Weight (Monoisotopic): 534.2762AlogP: 5.10#Rotatable Bonds: 9Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.11CX LogP: 4.34CX LogD: 1.78Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: -0.35
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,