US9340517, 493

ID: ALA3985611

PubChem CID: 46897442

Max Phase: Preclinical

Molecular Formula: C31H39ClN4O2

Molecular Weight: 535.13

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@H](CN1CC[C@H](CNC(=O)c2ccc3cc(Cl)ccc3c2)N[C@H](CC(C)(C)N)C1=O)c1ccccc1

Standard InChI:  InChI=1S/C31H39ClN4O2/c1-4-21(22-8-6-5-7-9-22)20-36-15-14-27(35-28(30(36)38)18-31(2,3)33)19-34-29(37)25-11-10-24-17-26(32)13-12-23(24)16-25/h5-13,16-17,21,27-28,35H,4,14-15,18-20,33H2,1-3H3,(H,34,37)/t21-,27-,28-/m1/s1

Standard InChI Key:  JCQMVGHNRJRBCG-KPGYKUMBSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  1  0  0  0  0  0999 V2000
    0.6645   -7.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1367   -8.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9732  -10.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4704   -9.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1298   -8.5578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1986   -7.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5374   -5.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9364    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2403   -5.9299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5691   -7.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0337   -7.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0567   -6.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7050   -5.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8743   -5.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2263   -6.9004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6298   -8.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1467   -9.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3146  -11.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1816  -11.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8371  -12.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9964  -14.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4998  -13.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1553  -12.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 16  1  0
 22 23  2  0
 23 13  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  6
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 25 31  1  0
 31  5  1  0
 31 32  2  0
  3 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.13Molecular Weight (Monoisotopic): 534.2762AlogP: 5.10#Rotatable Bonds: 9
Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.11CX LogP: 4.34CX LogD: 1.78
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: -0.35

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):