The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((1R,2S,3R)-3-hydroxy-2-(3-(hydroxy(1-propylcyclobutyl)methyl)phenyl)-5-oxocyclopentyl)-N,N-dimethylhept-5-enamide ID: ALA3985691
PubChem CID: 134157870
Max Phase: Preclinical
Molecular Formula: C28H41NO4
Molecular Weight: 455.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1(C(O)c2cccc([C@H]3[C@H](O)CC(=O)[C@@H]3C/C=C\CCCC(=O)N(C)C)c2)CCC1
Standard InChI: InChI=1S/C28H41NO4/c1-4-15-28(16-10-17-28)27(33)21-12-9-11-20(18-21)26-22(23(30)19-24(26)31)13-7-5-6-8-14-25(32)29(2)3/h5,7,9,11-12,18,22,24,26-27,31,33H,4,6,8,10,13-17,19H2,1-3H3/b7-5-/t22-,24+,26+,27?/m0/s1
Standard InChI Key: HGSARQJYWQRMHV-UVCBDWHZSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
25.0575 -6.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3408 -7.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7491 -8.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4658 -7.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1423 -5.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9673 -5.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2242 -4.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5548 -3.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8898 -4.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5536 -3.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6565 -5.7671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4515 -5.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1119 -6.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5954 -7.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4169 -7.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7527 -6.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2672 -5.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0091 -4.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6215 -4.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4065 -4.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5791 -3.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3642 -3.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5368 -2.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3218 -2.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4944 -1.4332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9342 -2.7929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2795 -1.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5730 -6.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9067 -5.5015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8798 -6.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3663 -7.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1866 -7.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8821 -0.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
5 11 1 6
6 12 1 1
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 1 6
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
16 28 1 0
28 1 1 0
28 29 1 0
1 30 1 0
30 31 1 0
31 32 1 0
25 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.64Molecular Weight (Monoisotopic): 455.3036AlogP: 4.93#Rotatable Bonds: 11Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.91CX Basic pKa: ┄CX LogP: 4.26CX LogD: 4.26Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: 1.11
References 1. (2010) Therapeutic compounds,