The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9145392, 328 ID: ALA3985709
PubChem CID: 117704726
Max Phase: Preclinical
Molecular Formula: C24H28F2N8O
Molecular Weight: 482.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(N)ncnc1N1CCC(c2nc(-c3ccc(F)c(F)c3)cn2CCN2CCC2)CC1
Standard InChI: InChI=1S/C24H28F2N8O/c25-17-3-2-16(12-18(17)26)19-13-34(11-10-32-6-1-7-32)23(31-19)15-4-8-33(9-5-15)24-20(22(28)35)21(27)29-14-30-24/h2-3,12-15H,1,4-11H2,(H2,28,35)(H2,27,29,30)
Standard InChI Key: ZGVJCAMSCAQSAM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.6375 -0.9049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5956 -2.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0072 -7.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2234 -8.3576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7644 -9.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7356 -9.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2036 -8.3653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 -7.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -8.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1720 -8.4324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4625 -9.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1374 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7979 -7.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6504 -10.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1446 -10.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9365 -12.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -13.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8627 -14.5632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7300 -13.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1642 -14.6512 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9381 -12.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 0
5 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 11 1 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 24 1 0
19 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
31 33 1 0
33 34 1 0
33 35 2 0
35 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.54Molecular Weight (Monoisotopic): 482.2354AlogP: 2.39#Rotatable Bonds: 7Polar Surface Area: 119.19Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.10CX Basic pKa: 8.39CX LogP: 2.74CX LogD: 1.69Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -1.55
References 1. (2015) Imidazole amines as modulators of kinase activity,