US9133148, 9az

ID: ALA3985722

PubChem CID: 71656214

Max Phase: Preclinical

Molecular Formula: C18H17F7N4O2

Molecular Weight: 454.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(-n3cccn3)c(F)c2)CC1

Standard InChI:  InChI=1S/C18H17F7N4O2/c19-13-10-12(2-3-14(13)29-5-1-4-26-29)11-27-6-8-28(9-7-27)16(30)31-15(17(20,21)22)18(23,24)25/h1-5,10,15H,6-9,11H2

Standard InChI Key:  LDWCADOAPYUVLM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9073    5.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021    3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6005    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2112    5.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2174    7.1836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5072    5.2269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8111    5.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1072    5.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1497    5.8076    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1432    4.6078    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1009    4.0134    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8158    7.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7789    8.0749    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8202    8.6709    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8571    8.0673    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2122   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7464   -5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7536   -5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2149   -3.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  6  1  0
  9 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
 15 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
  4 24  2  0
 24 25  1  0
 25 26  2  0
 26  2  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
M  END

Associated Targets(non-human)

Faah Anandamide amidohydrolase (476 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 454.35Molecular Weight (Monoisotopic): 454.1240AlogP: 3.76#Rotatable Bonds: 4
Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.13CX LogP: 3.81CX LogD: 3.78
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.91

References

1.  (2015)  Carbamate compounds and of making and using same, 

Source

Source(1):