The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9133148, 9az ID: ALA3985722
PubChem CID: 71656214
Max Phase: Preclinical
Molecular Formula: C18H17F7N4O2
Molecular Weight: 454.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(-n3cccn3)c(F)c2)CC1
Standard InChI: InChI=1S/C18H17F7N4O2/c19-13-10-12(2-3-14(13)29-5-1-4-26-29)11-27-6-8-28(9-7-27)16(30)31-15(17(20,21)22)18(23,24)25/h1-5,10,15H,6-9,11H2
Standard InChI Key: LDWCADOAPYUVLM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9073 5.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9021 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6005 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2112 5.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2174 7.1836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5072 5.2269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8111 5.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1072 5.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1497 5.8076 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.1432 4.6078 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-9.1009 4.0134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8158 7.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7789 8.0749 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8202 8.6709 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.8571 8.0673 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2122 -3.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7464 -5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 -5.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2149 -3.8587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 1 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
15 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
4 24 2 0
24 25 1 0
25 26 2 0
26 2 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.35Molecular Weight (Monoisotopic): 454.1240AlogP: 3.76#Rotatable Bonds: 4Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.13CX LogP: 3.81CX LogD: 3.78Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.91
References 1. (2015) Carbamate compounds and of making and using same,