US9321760, 75

ID: ALA3985746

PubChem CID: 89444953

Max Phase: Preclinical

Molecular Formula: C26H30F2N6

Molecular Weight: 464.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc(N2CCN(C(CN3CCCC3)c3ccc(F)cc3)CC2)c1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C26H30F2N6/c27-21-7-3-19(4-8-21)23(17-32-11-1-2-12-32)33-13-15-34(16-14-33)26-24(25(29)30-18-31-26)20-5-9-22(28)10-6-20/h3-10,18,23H,1-2,11-17H2,(H2,29,30,31)

Standard InChI Key:  GGRDNSPVEJQBBQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987   -1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945   -3.0046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5964   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -3.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4871   -5.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1854   -6.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0406   -7.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5719   -7.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8280   -6.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8369   -5.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7937   -3.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8008   -1.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1033   -0.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3988   -1.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4409   -0.9287    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3919   -3.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0893   -3.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067   -7.2009    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 13 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 20  1  0
  6 27  2  0
 27  2  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 34 28  1  0
M  END

Associated Targets(Human)

RPS6KB1 Tchem Ribosomal protein S6 kinase 1 (4456 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.56Molecular Weight (Monoisotopic): 464.2500AlogP: 3.96#Rotatable Bonds: 6
Polar Surface Area: 61.52Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.88CX LogP: 4.51CX LogD: 2.92
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.60Np Likeness Score: -1.14

References

1.  (2016)  Aminopyrimidine derivatives for use as modulators of kinase activity, 

Source

Source(1):