The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, C12, Table 23A, Compound 89 ID: ALA3985773
PubChem CID: 137306361
Max Phase: Preclinical
Molecular Formula: C23H25N7O4S
Molecular Weight: 495.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCOCCNC(=O)c1ccc(-c2cc(NC3CC3)n3ncc(/C=C4\NC(=O)NC4=O)c3n2)s1
Standard InChI: InChI=1S/C23H25N7O4S/c1-2-8-34-9-7-24-22(32)18-6-5-17(35-18)15-11-19(26-14-3-4-14)30-20(27-15)13(12-25-30)10-16-21(31)29-23(33)28-16/h5-6,10-12,14,26H,2-4,7-9H2,1H3,(H,24,32)(H2,28,29,31,33)/b16-10-
Standard InChI Key: ZITVOIZIQJRPAY-YBEGLDIGSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.2558 -13.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9641 -12.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3587 -11.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2445 -9.8362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6391 -8.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5250 -7.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 -5.8781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8054 -4.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9984 -4.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 19 1 0
17 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 27 1 0
32 33 2 0
25 34 2 0
34 22 1 0
34 35 1 0
35 15 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.57Molecular Weight (Monoisotopic): 495.1689AlogP: 2.37#Rotatable Bonds: 10Polar Surface Area: 138.75Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.24CX Basic pKa: 1.04CX LogP: 1.23CX LogD: 0.85Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.19Np Likeness Score: -1.54
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,