N-(3,4-dichlorophenyl)-6-(methyloxy)-7-[({5-[4-(methyloxy)phenyl]-1,2,4-oxadiazol-3-yl}methyl)oxy]quinazolin-4-amine

ID: ALA3985840

PubChem CID: 57802896

Max Phase: Preclinical

Molecular Formula: C25H19Cl2N5O4

Molecular Weight: 524.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nc(COc3cc4ncnc(Nc5ccc(Cl)c(Cl)c5)c4cc3OC)no2)cc1

Standard InChI:  InChI=1S/C25H19Cl2N5O4/c1-33-16-6-3-14(4-7-16)25-31-23(32-36-25)12-35-22-11-20-17(10-21(22)34-2)24(29-13-28-20)30-15-5-8-18(26)19(27)9-15/h3-11,13H,12H2,1-2H3,(H,28,29,30)

Standard InChI Key:  VKCKBMWVXBACHI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   23.3433  -13.5111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0530  -13.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0502  -12.2790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3415  -11.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6353  -13.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6376  -12.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9316  -11.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2229  -12.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2246  -13.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9311  -13.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5152  -11.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5150  -11.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5179  -13.5140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3380  -11.0565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0440  -10.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7529  -11.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4584  -10.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4553   -9.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7409   -9.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0384   -9.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1607   -9.4104    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.1676  -11.0469    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.8092  -13.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1025  -13.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3565  -13.1882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8112  -13.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2215  -14.5036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0203  -14.3317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0028  -13.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6694  -12.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8573  -12.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3776  -13.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7159  -14.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5270  -14.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5646  -13.4635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2295  -12.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  8 11  1  0
 11 12  1  0
  9 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 17 22  1  0
 13 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 24  2  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 26 29  1  0
 32 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

EPHB4 Tchem Ephrin type-B receptor 4 (3198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EPHA2 Tclin Ephrin type-A receptor 2 (3499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KDR Tclin Vascular endothelial growth factor receptor 2 (20924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.36Molecular Weight (Monoisotopic): 523.0814AlogP: 6.33#Rotatable Bonds: 8
Polar Surface Area: 104.42Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.93CX LogP: 5.88CX LogD: 5.88
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.49

References

1.  (2009)  Receptor-type kinase modulators and methods of use, 

Source