The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{N-[3-(4-Fluorophenyl)-1H-Indazol-5-yl)Carbamoyl}Benzamide ID: ALA3986024
PubChem CID: 22480268
Max Phase: Preclinical
Molecular Formula: C21H15FN4O2
Molecular Weight: 374.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc(C(=O)Nc2ccc3[nH]nc(-c4ccc(F)cc4)c3c2)cc1
Standard InChI: InChI=1S/C21H15FN4O2/c22-15-7-5-12(6-8-15)19-17-11-16(9-10-18(17)25-26-19)24-21(28)14-3-1-13(2-4-14)20(23)27/h1-11H,(H2,23,27)(H,24,28)(H,25,26)
Standard InChI Key: NIRFNOJTUGHNDO-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
25.4966 -0.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4955 -1.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2035 -2.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2017 -0.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9103 -0.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9151 -1.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6952 -1.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1725 -1.2444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6874 -0.5850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9509 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4059 -3.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6624 -4.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4634 -4.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0076 -3.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7482 -2.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7874 -2.0736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7215 -5.0074 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.0800 -1.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3720 -2.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0807 -0.8473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6654 -1.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9578 -2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9567 -2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6691 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3737 -2.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2493 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5413 -2.8873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2497 -4.1127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
2 16 1 0
13 17 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
23 26 1 0
26 27 2 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.38Molecular Weight (Monoisotopic): 374.1179AlogP: 3.72#Rotatable Bonds: 4Polar Surface Area: 100.87Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.61CX Basic pKa: 1.79CX LogP: 3.41CX LogD: 3.41Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.70
References 1. (2002) Indazole derivatives as JNK inhibitors and compositions and methods related thereto,