US9206164, 50

ID: ALA3986049

PubChem CID: 122198000

Max Phase: Preclinical

Molecular Formula: C23H22F2N4O2

Molecular Weight: 424.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn(Cc2ccc(-c3nc4c(F)cc(F)cc4[nH]3)cc2)c(CC)c1CC(=O)O

Standard InChI:  InChI=1S/C23H22F2N4O2/c1-3-18-16(11-21(30)31)20(4-2)29(28-18)12-13-5-7-14(8-6-13)23-26-19-10-15(24)9-17(25)22(19)27-23/h5-10H,3-4,11-12H2,1-2H3,(H,26,27)(H,30,31)

Standard InChI Key:  LBHHLIPTXISHIL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -0.5893  -10.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3218  -11.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7353  -11.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1617   -9.7384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6488   -9.7176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4967   -8.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8490   -7.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6946   -5.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0445   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5536   -4.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7031   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1616  -11.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6003  -11.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8875  -12.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9713  -12.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0070  -13.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7260  -14.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7547  -15.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6726  -13.7316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  2  0
 22 15  1  0
 22 23  1  0
 23 13  1  0
  5 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  2  0
 27  3  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3986049

    ---

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.45Molecular Weight (Monoisotopic): 424.1711AlogP: 4.50#Rotatable Bonds: 7
Polar Surface Area: 83.80Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.53CX Basic pKa: 3.85CX LogP: 4.40CX LogD: 1.97
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.24

References

1.  (2015)  Pyrazole compounds as CRTH2 antagonists, 

Source

Source(1):