The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9206164, 50 ID: ALA3986049
PubChem CID: 122198000
Max Phase: Preclinical
Molecular Formula: C23H22F2N4O2
Molecular Weight: 424.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn(Cc2ccc(-c3nc4c(F)cc(F)cc4[nH]3)cc2)c(CC)c1CC(=O)O
Standard InChI: InChI=1S/C23H22F2N4O2/c1-3-18-16(11-21(30)31)20(4-2)29(28-18)12-13-5-7-14(8-6-13)23-26-19-10-15(24)9-17(25)22(19)27-23/h5-10H,3-4,11-12H2,1-2H3,(H,26,27)(H,30,31)
Standard InChI Key: LBHHLIPTXISHIL-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.5893 -10.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3218 -11.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7353 -11.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1617 -9.7384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6488 -9.7176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4967 -8.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8490 -7.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6946 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0445 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5536 -4.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7031 -5.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3532 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1616 -11.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6003 -11.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -12.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9713 -12.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0070 -13.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7260 -14.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7547 -15.5060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6726 -13.7316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 2 0
22 15 1 0
22 23 1 0
23 13 1 0
5 24 1 0
24 25 1 0
25 26 1 0
24 27 2 0
27 3 1 0
27 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.45Molecular Weight (Monoisotopic): 424.1711AlogP: 4.50#Rotatable Bonds: 7Polar Surface Area: 83.80Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.53CX Basic pKa: 3.85CX LogP: 4.40CX LogD: 1.97Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.24
References 1. (2015) Pyrazole compounds as CRTH2 antagonists,