The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9253997, 32 ID: ALA3986052
PubChem CID: 71542641
Max Phase: Preclinical
Molecular Formula: C19H21Cl2N3O6S
Molecular Weight: 490.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)Nc1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)NCCc1cccc(Cl)c1
Standard InChI: InChI=1S/C19H21Cl2N3O6S/c20-12-3-1-2-11(8-12)6-7-23-19(27)14(22)4-5-17(25)24-15-9-13(21)10-16(18(15)26)31(28,29)30/h1-3,8-10,14,26H,4-7,22H2,(H,23,27)(H,24,25)(H,28,29,30)/t14-/m0/s1
Standard InChI Key: MALJWUBSEFTRCS-AWEZNQCLSA-N
Molfile:
RDKit 2D
31 32 0 0 1 0 0 0 0 0999 V2000
7.8024 -2.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 -1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6384 -0.9011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5984 -2.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6377 -2.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0969 0.4636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4003 -1.4841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6990 -0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0002 -1.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2989 -0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6006 -1.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8971 -0.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8919 0.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5902 1.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5861 2.7272 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.2938 0.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
10 12 2 0
12 13 1 0
13 14 2 0
14 8 1 0
14 15 1 0
13 16 1 0
16 17 2 0
16 18 2 0
16 19 1 0
2 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
31 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.37Molecular Weight (Monoisotopic): 489.0528AlogP: 2.35#Rotatable Bonds: 9Polar Surface Area: 158.82Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: -2.82CX Basic pKa: 8.22CX LogP: 1.66CX LogD: 1.60Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.27Np Likeness Score: -0.72
References 1. (2016) Alkylamine derivative,