The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,4:3,6-dianhydro-2-O-[4-[(4-bromo-3-chlorophenyl)amino]-6-(methyloxy)quinazolin-7-yl]-5-O-(methylsulfonyl)-D-glucitol ID: ALA3986082
PubChem CID: 134156813
Max Phase: Preclinical
Molecular Formula: C22H21BrClN3O7S
Molecular Weight: 586.85
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cc1O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OS(C)(=O)=O
Standard InChI: InChI=1S/C22H21BrClN3O7S/c1-30-16-6-12-15(25-10-26-22(12)27-11-3-4-13(23)14(24)5-11)7-17(16)33-18-8-31-21-19(9-32-20(18)21)34-35(2,28)29/h3-7,10,18-21H,8-9H2,1-2H3,(H,25,26,27)/t18-,19+,20-,21-/m1/s1
Standard InChI Key: PWDUFJSWDUGFRW-PLACYPQZSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
1.1666 -18.5664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9916 -18.5664 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5791 -17.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6390 -17.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1554 -16.0480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9476 -16.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9817 -16.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2783 -16.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1022 -16.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3149 -15.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6222 -15.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5781 -14.6584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -18.1173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6101 -17.5283 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6365 -15.2470 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.4299 -14.6553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1487 -14.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1445 -13.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4287 -13.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7135 -14.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7171 -13.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0039 -13.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2906 -13.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2898 -14.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0031 -14.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5748 -13.0058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4287 -12.1757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1383 -11.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8524 -12.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5675 -11.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5629 -10.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8454 -10.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1332 -10.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8606 -13.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2746 -10.5173 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.2840 -12.1710 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0381 -19.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 8 1 0
7 5 1 0
5 6 1 0
6 4 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
11 12 1 6
4 13 1 1
8 14 1 1
7 15 1 1
20 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 21 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 20 2 0
23 26 1 0
24 12 1 0
19 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 28 2 0
26 34 1 0
31 35 1 0
30 36 1 0
13 2 1 0
2 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.85Molecular Weight (Monoisotopic): 584.9972AlogP: 3.69#Rotatable Bonds: 7Polar Surface Area: 118.10Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.59CX LogP: 3.57CX LogD: 3.56Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.54
References 1. (2009) Receptor-type kinase modulators and methods of use,