The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9133148, 11y ID: ALA3986085
PubChem CID: 89682826
Max Phase: Preclinical
Molecular Formula: C26H27F6N3O3
Molecular Weight: 543.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(-c3ccccc3)cc2C(=O)N2CCCC2)CC1
Standard InChI: InChI=1S/C26H27F6N3O3/c27-25(28,29)23(26(30,31)32)38-24(37)35-14-12-33(13-15-35)17-20-9-8-19(18-6-2-1-3-7-18)16-21(20)22(36)34-10-4-5-11-34/h1-3,6-9,16,23H,4-5,10-15,17H2
Standard InChI Key: XDTLSBULVQNXBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
4.9292 -5.8600 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8509 -5.8560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8889 -6.4578 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8939 -0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1903 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 -0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4972 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2007 1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2091 2.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1730 3.5971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5125 3.7357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.6607 5.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1300 5.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8710 4.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8595 3.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7891 -1.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7863 -3.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0840 -3.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3844 -3.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3872 -1.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0896 -0.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1932 -1.8062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2322 -2.4063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -3.6062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
17 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
12 33 1 0
33 34 1 0
34 9 1 0
5 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.51Molecular Weight (Monoisotopic): 543.1957AlogP: 5.34#Rotatable Bonds: 5Polar Surface Area: 53.09Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.33CX LogP: 4.93CX LogD: 4.89Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.48Np Likeness Score: -0.96
References 1. (2015) Carbamate compounds and of making and using same,