US9133148, 11y

ID: ALA3986085

PubChem CID: 89682826

Max Phase: Preclinical

Molecular Formula: C26H27F6N3O3

Molecular Weight: 543.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(-c3ccccc3)cc2C(=O)N2CCCC2)CC1

Standard InChI:  InChI=1S/C26H27F6N3O3/c27-25(28,29)23(26(30,31)32)38-24(37)35-14-12-33(13-15-35)17-20-9-8-19(18-6-2-1-3-7-18)16-21(20)22(36)34-10-4-5-11-34/h1-3,6-9,16,23H,4-5,10-15,17H2

Standard InChI Key:  XDTLSBULVQNXBA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    4.9292   -5.8600    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8509   -5.8560    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8889   -6.4578    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2091    2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1730    3.5971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5125    3.7357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6607    5.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1300    5.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8710    4.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8595    3.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7891   -1.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7863   -3.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0840   -3.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3844   -3.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3872   -1.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0896   -0.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1929   -3.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1932   -1.8062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2322   -2.4063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2321   -3.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 17 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 12 33  1  0
 33 34  1  0
 34  9  1  0
  5 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
M  END

Associated Targets(non-human)

Faah Anandamide amidohydrolase (476 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 543.51Molecular Weight (Monoisotopic): 543.1957AlogP: 5.34#Rotatable Bonds: 5
Polar Surface Area: 53.09Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.33CX LogP: 4.93CX LogD: 4.89
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.48Np Likeness Score: -0.96

References

1.  (2015)  Carbamate compounds and of making and using same, 

Source

Source(1):