US9328118, 105

ID: ALA3986133

PubChem CID: 117914123

Max Phase: Preclinical

Molecular Formula: C31H35F3N6O3

Molecular Weight: 596.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCC[C@H]1C(=O)N1CCC(COc2ccc(-c3nc(C#N)nc4c3ccn4CC3CCOC3)cc2C(F)(F)F)CC1

Standard InChI:  InChI=1S/C31H35F3N6O3/c1-38-10-2-3-25(38)30(41)39-11-6-20(7-12-39)19-43-26-5-4-22(15-24(26)31(32,33)34)28-23-8-13-40(17-21-9-14-42-18-21)29(23)37-27(16-35)36-28/h4-5,8,13,15,20-21,25H,2-3,6-7,9-12,14,17-19H2,1H3/t21?,25-/m0/s1

Standard InChI Key:  MMEINBVTJIYTIG-QBGQUKIHSA-N

Molfile:  

     RDKit          2D

 43 48  0  0  1  0  0  0  0  0999 V2000
   10.6280   -7.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7651   -8.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2215   -9.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7214   -9.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1921   -8.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9830   -7.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9875   -6.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0287   -5.4166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6904   -5.2581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6928   -3.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3949   -3.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0946   -3.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945   -3.0041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4946   -3.7543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8919   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8521   -5.8523    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9304   -5.8546    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8906   -6.4533    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8823   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3600   -2.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9656   -3.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8476   -4.7650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5510   -4.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0923   -5.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3902   -6.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  6  7  1  6
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 18 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 35  1  0
 27 40  1  0
 40 41  3  0
 12 42  1  0
 42 43  1  0
 43  9  1  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ctss Cathepsin S (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 596.65Molecular Weight (Monoisotopic): 596.2723AlogP: 4.74#Rotatable Bonds: 7
Polar Surface Area: 96.51Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.10CX LogP: 4.21CX LogD: 3.44
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.39Np Likeness Score: -1.07

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):