The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,8aS)-3-({[4-[(4-bromo-3-chloro-2-fluorophenyl)amino]-6-(methyloxy)quinazolin-7-yl]oxy}methyl)hexahydropyrrolo[1,2-a]pyrazin-1(2H)-one ID: ALA3986135
PubChem CID: 57802807
Max Phase: Preclinical
Molecular Formula: C23H22BrClFN5O3
Molecular Weight: 550.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Br)c(Cl)c3F)ncnc2cc1OC[C@@H]1CN2CCC[C@H]2C(=O)N1
Standard InChI: InChI=1S/C23H22BrClFN5O3/c1-33-18-7-13-16(27-11-28-22(13)30-15-5-4-14(24)20(25)21(15)26)8-19(18)34-10-12-9-31-6-2-3-17(31)23(32)29-12/h4-5,7-8,11-12,17H,2-3,6,9-10H2,1H3,(H,29,32)(H,27,28,30)/t12-,17-/m0/s1
Standard InChI Key: OEGXYNWEJSFYPO-SJCJKPOMSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
17.9025 -9.0675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3191 -9.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3162 -9.0639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6076 -8.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6094 -10.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9014 -9.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1953 -10.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1960 -11.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9087 -11.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6119 -11.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0274 -10.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7345 -9.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4395 -10.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1461 -9.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1452 -9.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4319 -8.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7283 -9.0692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0179 -8.6652 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.4278 -7.8407 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.8518 -8.6545 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
17.9128 -12.3373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6225 -12.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4894 -11.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4917 -12.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7851 -12.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0801 -12.3414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3757 -12.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7930 -13.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6671 -12.3414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0777 -13.9773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3789 -13.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7715 -14.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0948 -14.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9021 -14.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6653 -13.1535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
16 19 1 0
15 20 1 0
9 21 1 0
21 22 1 0
8 23 1 0
23 24 1 0
25 24 1 6
25 26 1 0
25 28 1 0
26 27 1 0
27 31 1 0
30 28 1 0
27 29 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
31 35 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.82Molecular Weight (Monoisotopic): 549.0579AlogP: 4.28#Rotatable Bonds: 6Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.64CX Basic pKa: 7.60CX LogP: 4.08CX LogD: 3.66Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.48
References 1. (2009) Receptor-type kinase modulators and methods of use,