The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 115::US9340517, 138 ID: ALA3986205
PubChem CID: 44206473
Max Phase: Preclinical
Molecular Formula: C31H38N6O2
Molecular Weight: 526.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H]1N[C@H](CNC(=O)c2ccccc2)CCN(CC(c2ccccc2)c2ccccc2)C1=O
Standard InChI: InChI=1S/C31H38N6O2/c32-31(33)34-19-10-17-28-30(39)37(20-18-26(36-28)21-35-29(38)25-15-8-3-9-16-25)22-27(23-11-4-1-5-12-23)24-13-6-2-7-14-24/h1-9,11-16,26-28,36H,10,17-22H2,(H,35,38)(H4,32,33,34)/t26-,28-/m0/s1
Standard InChI Key: WBKKFYBGSRVUDI-XCZPVHLTSA-N
Molfile:
RDKit 2D
39 42 0 0 1 0 0 0 0 0999 V2000
8.4730 -0.3208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1173 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9323 1.7061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6534 1.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6342 0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1703 0.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1510 -0.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0030 3.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.9799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3069 5.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2687 6.0825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6077 6.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6130 7.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9146 8.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2110 7.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2059 6.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9043 5.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4048 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5555 -4.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0513 -4.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7022 -5.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8572 -7.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3614 -6.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7106 -5.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7448 -1.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2411 -1.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0822 -0.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4272 0.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9311 0.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0899 -0.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2707 -2.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 7 1 1
8 9 1 0
9 10 1 0
10 11 1 1
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
10 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
23 38 1 0
38 8 1 0
38 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.69Molecular Weight (Monoisotopic): 526.3056AlogP: 3.07#Rotatable Bonds: 11Polar Surface Area: 123.34Molecular Species: BASEHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 12.01CX LogP: 2.92CX LogD: 0.21Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -0.06
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,