US9340517, 115::US9340517, 138

ID: ALA3986205

PubChem CID: 44206473

Max Phase: Preclinical

Molecular Formula: C31H38N6O2

Molecular Weight: 526.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H]1N[C@H](CNC(=O)c2ccccc2)CCN(CC(c2ccccc2)c2ccccc2)C1=O

Standard InChI:  InChI=1S/C31H38N6O2/c32-31(33)34-19-10-17-28-30(39)37(20-18-26(36-28)21-35-29(38)25-15-8-3-9-16-25)22-27(23-11-4-1-5-12-23)24-13-6-2-7-14-24/h1-9,11-16,26-28,36H,10,17-22H2,(H,35,38)(H4,32,33,34)/t26-,28-/m0/s1

Standard InChI Key:  WBKKFYBGSRVUDI-XCZPVHLTSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    8.4730   -0.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1173    0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9323    1.7061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6534    1.1562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6342    0.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1703    0.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1510   -0.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0030    3.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3069    5.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2687    6.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6077    6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6130    7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9146    8.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2110    7.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2059    6.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9043    5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7448   -1.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2411   -1.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0822   -0.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4272    0.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9311    0.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2707   -2.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  7  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  1
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 23 38  1  0
 38  8  1  0
 38 39  2  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.69Molecular Weight (Monoisotopic): 526.3056AlogP: 3.07#Rotatable Bonds: 11
Polar Surface Area: 123.34Molecular Species: BASEHBA: 4HBD: 5
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 12.01CX LogP: 2.92CX LogD: 0.21
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -0.06

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):