The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, R11, Table 23A, Compound 78 ID: ALA3986306
PubChem CID: 137316456
Max Phase: Preclinical
Molecular Formula: C24H24N8O4S
Molecular Weight: 520.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(C(=O)c2ccc(-c3cc(NC4CC4)n4ncc(/C=C5\NC(=O)NC5=O)c4n3)s2)CC1
Standard InChI: InChI=1S/C24H24N8O4S/c1-13(33)30-6-8-31(9-7-30)23(35)19-5-4-18(37-19)16-11-20(26-15-2-3-15)32-21(27-16)14(12-25-32)10-17-22(34)29-24(36)28-17/h4-5,10-12,15,26H,2-3,6-9H2,1H3,(H2,28,29,34,36)/b17-10-
Standard InChI Key: PLOQVCMOMPRCSG-YVLHZVERSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
1.7337 -10.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2531 -9.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0605 -9.3710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 -8.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6348 -8.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5226 -7.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 -5.8781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4285 -5.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5407 -6.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8054 -4.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9984 -4.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 21 1 0
19 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 29 1 0
34 35 2 0
27 36 2 0
36 24 1 0
36 37 1 0
37 17 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.58Molecular Weight (Monoisotopic): 520.1641AlogP: 1.52#Rotatable Bonds: 5Polar Surface Area: 141.04Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.24CX Basic pKa: 1.04CX LogP: -0.30CX LogD: -0.68Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.43
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,