3-(3,5-difluorophenyl)-2-(4-(methylsulfonyl)phenyl)-1-oxaspiro[4.4]non-2-en-4-one

ID: ALA3986333

PubChem CID: 18385985

Max Phase: Preclinical

Molecular Formula: C21H18F2O4S

Molecular Weight: 404.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1ccc(C2=C(c3cc(F)cc(F)c3)C(=O)C3(CCCC3)O2)cc1

Standard InChI:  InChI=1S/C21H18F2O4S/c1-28(25,26)17-6-4-13(5-7-17)19-18(14-10-15(22)12-16(23)11-14)20(24)21(27-19)8-2-3-9-21/h4-7,10-12H,2-3,8-9H2,1H3

Standard InChI Key:  RSGRKGMCRNCVJN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   24.0659  -13.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8831  -13.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1374  -13.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4745  -12.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8157  -13.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1643   -7.9998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1261   -8.8199    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.8554   -8.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8138  -12.2280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1373  -12.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8798  -11.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0635  -11.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9152  -12.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5803  -10.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9096  -10.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4259   -9.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6128   -9.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2858  -10.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7716  -10.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3522  -10.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1665  -10.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6418  -10.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3040   -9.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4862   -9.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0145  -10.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3154   -8.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4551  -10.2786    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.1457   -8.6336    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  7  6  2  0
  8  7  2  0
  9  4  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12  9  1  0
 10 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 11 20  1  0
 17  7  1  0
  7 26  1  0
 22 27  1  0
 24 28  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 404.43Molecular Weight (Monoisotopic): 404.0894AlogP: 4.15#Rotatable Bonds: 3
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.77Np Likeness Score: -0.38

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source