The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,4:3,6-dianhydro-2-O-[4-[(3,4-dichloro-2-fluorophenyl)amino]-6-(methyloxy)quinazolin-7-y1]-5-O-methyl-L-iditol ID: ALA3986404
PubChem CID: 134156210
Max Phase: Preclinical
Molecular Formula: C22H20Cl2FN3O5
Molecular Weight: 496.32
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1O[C@@H]1C[C@H]2OC[C@H](OC)[C@H]2O1
Standard InChI: InChI=1S/C22H20Cl2FN3O5/c1-29-14-5-10-13(6-15(14)32-18-7-16-21(33-18)17(30-2)8-31-16)26-9-27-22(10)28-12-4-3-11(23)19(24)20(12)25/h3-6,9,16-18,21H,7-8H2,1-2H3,(H,26,27,28)/t16-,17+,18+,21+/m1/s1
Standard InChI Key: CMDXLFALYMWXLO-WKRCXCSHSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.9194 -4.2465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7355 -4.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1761 -4.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9140 -3.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1002 -3.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3634 -4.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9907 -4.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4340 -5.5316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -5.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6206 -4.7578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1751 -4.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5445 -3.3476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3605 -3.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8056 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6208 -3.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9911 -3.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5401 -2.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7264 -2.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6519 -2.7946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0194 -2.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5483 -4.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7401 -5.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9180 -5.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3402 -6.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6114 -5.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 -6.4895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4050 -7.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 -7.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8985 -5.5016 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0447 -6.6902 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4353 -4.7166 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7907 -7.6672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5795 -8.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8070 -3.1690 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.0670 -4.6287 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 7 1 0
6 4 1 0
4 5 2 0
5 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
5 19 1 0
19 20 1 0
21 1 1 1
21 22 1 0
22 25 1 0
24 23 1 0
23 21 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
25 29 1 1
24 30 1 1
14 31 1 0
28 32 1 1
32 33 1 0
16 34 1 0
15 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.32Molecular Weight (Monoisotopic): 495.0764AlogP: 4.74#Rotatable Bonds: 6Polar Surface Area: 83.96Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.99CX Basic pKa: 4.32CX LogP: 4.79CX LogD: 4.79Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.19
References 1. (2009) Receptor-type kinase modulators and methods of use,