US9340517, 459

ID: ALA3986407

PubChem CID: 127054263

Max Phase: Preclinical

Molecular Formula: C30H33F3N4O2

Molecular Weight: 538.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCC[C@H]1N[C@@H](CNC(=O)c2ccc(C(F)(F)F)cc2)CCN(CC(c2ccccc2)c2ccccc2)C1=O

Standard InChI:  InChI=1S/C30H33F3N4O2/c31-30(32,33)24-13-11-23(12-14-24)28(38)35-19-25-16-18-37(29(39)27(36-25)15-17-34)20-26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,25-27,36H,15-20,34H2,(H,35,38)/t25-,27-/m1/s1

Standard InChI Key:  CBFIYCZMOUVLSR-XNMGPUDCSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    5.3407    0.1209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1703    0.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1510   -0.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0030    3.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3069    5.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2687    6.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6077    6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6130    7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9146    8.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2110    7.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2059    6.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9043    5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    8.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5182    9.6664    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5503    7.8625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5549    9.0623    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7448   -1.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2411   -1.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0822   -0.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4272    0.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9311    0.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2707   -2.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  6
  4  5  1  0
  5  6  1  0
  6  7  1  6
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
  6 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 23 38  1  0
 38  4  1  0
 38 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3986407

    ---

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.61Molecular Weight (Monoisotopic): 538.2556AlogP: 4.18#Rotatable Bonds: 9
Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.65CX LogP: 3.61CX LogD: 1.42
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.38Np Likeness Score: -0.39

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):