The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-2-(oxazol-4-yl)phenoxy)acetic acid ID: ALA3986455
PubChem CID: 59232335
Max Phase: Preclinical
Molecular Formula: C24H27N3O7S
Molecular Weight: 501.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3ccc(-c4cocn4)c(OCC(=O)O)c3)CC2)cc1
Standard InChI: InChI=1S/C24H27N3O7S/c1-17(2)34-19-4-6-20(7-5-19)35(30,31)27-11-9-26(10-12-27)18-3-8-21(22-14-32-16-25-22)23(13-18)33-15-24(28)29/h3-8,13-14,16-17H,9-12,15H2,1-2H3,(H,28,29)
Standard InChI Key: YXUHWUUHJFUDQO-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
7.6271 -1.0236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0398 -1.7334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4483 -1.0211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8039 -3.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8027 -4.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5108 -4.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2204 -4.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2176 -3.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5090 -2.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9213 -2.9613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6304 -3.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3344 -2.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3356 -2.1440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6265 -1.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9162 -2.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5106 -5.4217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8028 -5.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8026 -6.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0948 -7.0558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5102 -7.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7510 -2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7470 -2.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4538 -3.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1625 -2.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1599 -2.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4525 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8708 -3.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5779 -2.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2862 -3.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5769 -2.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0974 -4.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3511 -4.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8038 -4.8808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2119 -5.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0113 -5.4195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
5 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.56Molecular Weight (Monoisotopic): 501.1570AlogP: 3.10#Rotatable Bonds: 9Polar Surface Area: 122.41Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.12CX Basic pKa: 0.77CX LogP: 2.68CX LogD: -0.41Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.38
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,