The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9255090, 67 ID: ALA3986474
PubChem CID: 89649359
Max Phase: Preclinical
Molecular Formula: C28H26FN3O4
Molecular Weight: 487.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)O)cc1-c1ccc(F)c2c1CN(C(=O)CCn1ncc3ccccc31)CC2
Standard InChI: InChI=1S/C28H26FN3O4/c1-36-26-9-6-18(15-28(34)35)14-22(26)20-7-8-24(29)21-10-12-31(17-23(20)21)27(33)11-13-32-25-5-3-2-4-19(25)16-30-32/h2-9,14,16H,10-13,15,17H2,1H3,(H,34,35)
Standard InChI Key: TZKCFDSLRHGDHE-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
4.9456 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9046 0.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5825 -7.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5496 -5.3964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2959 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3341 -5.8527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0049 -5.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0080 -7.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3088 -8.2488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6581 -7.6233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6655 -8.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9200 -10.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3883 -11.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3883 -12.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9201 -12.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4518 -10.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4518 -9.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
6 11 1 0
11 12 2 0
12 3 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 13 1 0
23 18 2 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 28 1 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.53Molecular Weight (Monoisotopic): 487.1907AlogP: 4.45#Rotatable Bonds: 7Polar Surface Area: 84.66Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.19CX Basic pKa: 1.49CX LogP: 3.81CX LogD: 0.77Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: -1.15
References 1. (2016) Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators,