US9328118, 76

ID: ALA3986572

PubChem CID: 117914066

Max Phase: Preclinical

Molecular Formula: C23H24F3N5O

Molecular Weight: 443.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1ccc2c(-c3ccc(OCCC4CCNCC4)c(C(F)(F)F)c3)nc(C#N)nc21

Standard InChI:  InChI=1S/C23H24F3N5O/c1-2-31-11-7-17-21(29-20(14-27)30-22(17)31)16-3-4-19(18(13-16)23(24,25)26)32-12-8-15-5-9-28-10-6-15/h3-4,7,11,13,15,28H,2,5-6,8-10,12H2,1H3

Standard InChI Key:  QLBFQFIEBQBFLC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.3167   -5.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6380    2.1004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969    1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945    3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4946    3.7544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945    3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0946    3.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3945    3.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6950    3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9926    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9898    1.4989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6894    0.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917    1.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5964    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8919    5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9298    5.8556    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8515    5.8513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8894    6.4533    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  3  1  0
 11  6  1  0
  9 12  1  0
 12 13  3  0
  7 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 21  1  0
 17 27  1  0
 27 28  2  0
 28 14  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.1933AlogP: 4.78#Rotatable Bonds: 6
Polar Surface Area: 75.76Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.36CX LogP: 4.78CX LogD: 1.97
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -0.95

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):