The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 76 ID: ALA3986572
PubChem CID: 117914066
Max Phase: Preclinical
Molecular Formula: C23H24F3N5O
Molecular Weight: 443.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1ccc2c(-c3ccc(OCCC4CCNCC4)c(C(F)(F)F)c3)nc(C#N)nc21
Standard InChI: InChI=1S/C23H24F3N5O/c1-2-31-11-7-17-21(29-20(14-27)30-22(17)31)16-3-4-19(18(13-16)23(24,25)26)32-12-8-15-5-9-28-10-6-15/h3-4,7,11,13,15,28H,2,5-6,8-10,12H2,1H3
Standard InChI Key: QLBFQFIEBQBFLC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.3167 -5.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6380 2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 3.7544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 3.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3945 3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6950 3.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9926 2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9898 1.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6894 0.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 1.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8919 5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9298 5.8556 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8515 5.8513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 6.4533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 3 1 0
11 6 1 0
9 12 1 0
12 13 3 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 21 1 0
17 27 1 0
27 28 2 0
28 14 1 0
27 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.1933AlogP: 4.78#Rotatable Bonds: 6Polar Surface Area: 75.76Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.36CX LogP: 4.78CX LogD: 1.97Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -0.95
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,