US9255090, 307

ID: ALA3986652

PubChem CID: 89649219

Max Phase: Preclinical

Molecular Formula: C29H25F4NO5

Molecular Weight: 543.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)Cc1ccc(OCC(F)(F)F)c(-c2ccc(F)c3c2CN(C(=O)CC2COc4ccccc42)CC3)c1

Standard InChI:  InChI=1S/C29H25F4NO5/c30-24-7-6-20(22-11-17(12-28(36)37)5-8-26(22)39-16-29(31,32)33)23-14-34(10-9-21(23)24)27(35)13-18-15-38-25-4-2-1-3-19(18)25/h1-8,11,18H,9-10,12-16H2,(H,36,37)

Standard InChI Key:  ZSNLBUJUWVMNBH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    1.5496   -5.3964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5825   -7.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046    0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2066    1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2121    2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2532    3.5924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.1749    3.5991    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2160    4.1956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2959   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3341   -5.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049   -5.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2054   -8.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7416   -9.7868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7576   -9.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7615  -10.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2287  -10.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6919   -9.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6881   -8.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2209   -8.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
 11 14  1  0
  8 15  1  0
 15 16  2  0
 16  5  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 17  1  0
 27 22  2  0
 25 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 31  1  0
 39 34  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.51Molecular Weight (Monoisotopic): 543.1669AlogP: 5.51#Rotatable Bonds: 7
Polar Surface Area: 76.07Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.21CX Basic pKa: CX LogP: 4.97CX LogD: 1.94
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.40Np Likeness Score: -0.57

References

1.  (2016)  Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):