US9247759, 4-75

ID: ALA3986724

PubChem CID: 57422304

Max Phase: Preclinical

Molecular Formula: C19H18N4O3

Molecular Weight: 350.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc2cc(C(=O)Nc3cnn(Cc4c(C)noc4C)c3)ccc2o1

Standard InChI:  InChI=1S/C19H18N4O3/c1-11-6-15-7-14(4-5-18(15)25-11)19(24)21-16-8-20-23(9-16)10-17-12(2)22-26-13(17)3/h4-9H,10H2,1-3H3,(H,21,24)

Standard InChI Key:  MNFKCCXCAXGWKZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    2.4032   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024    2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5517    0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5554    1.9869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8054    3.2859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4120    4.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5281    5.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9995    7.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1417    7.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7829    8.1568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5725    7.2709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0410    5.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3448    4.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3382    2.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10  2  2  0
  7 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 17 26  1  0
 26 14  2  0
M  END

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.38Molecular Weight (Monoisotopic): 350.1379AlogP: 3.84#Rotatable Bonds: 4
Polar Surface Area: 86.09Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.71CX LogP: 2.27CX LogD: 2.27
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: -2.05

References

1.  (2016)  Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof, 

Source

Source(1):