The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9247759, 4-75 ID: ALA3986724
PubChem CID: 57422304
Max Phase: Preclinical
Molecular Formula: C19H18N4O3
Molecular Weight: 350.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2cc(C(=O)Nc3cnn(Cc4c(C)noc4C)c3)ccc2o1
Standard InChI: InChI=1S/C19H18N4O3/c1-11-6-15-7-14(4-5-18(15)25-11)19(24)21-16-8-20-23(9-16)10-17-12(2)22-26-13(17)3/h4-9H,10H2,1-3H3,(H,21,24)
Standard InChI Key: MNFKCCXCAXGWKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
2.4032 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5517 0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5554 1.9869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8054 3.2859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.4120 4.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5281 5.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9995 7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1417 7.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7829 8.1568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5725 7.2709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0410 5.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3448 4.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3382 2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 2 2 0
7 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
17 26 1 0
26 14 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 350.38Molecular Weight (Monoisotopic): 350.1379AlogP: 3.84#Rotatable Bonds: 4Polar Surface Area: 86.09Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.71CX LogP: 2.27CX LogD: 2.27Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: -2.05
References 1. (2016) Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof,