US9340517, 403

ID: ALA3986734

PubChem CID: 127054208

Max Phase: Preclinical

Molecular Formula: C29H44Cl2N4O2

Molecular Weight: 551.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1CC(C)CC(CN2CC[C@H](CNC(=O)c3ccc(Cl)c(Cl)c3)N[C@H](CCN3CCCCC3)C2=O)C1

Standard InChI:  InChI=1S/C29H44Cl2N4O2/c1-20-14-21(2)16-22(15-20)19-35-13-8-24(18-32-28(36)23-6-7-25(30)26(31)17-23)33-27(29(35)37)9-12-34-10-4-3-5-11-34/h6-7,17,20-22,24,27,33H,3-5,8-16,18-19H2,1-2H3,(H,32,36)/t20?,21?,22?,24-,27-/m1/s1

Standard InChI Key:  JHFWVCSWKAZHNG-VJUIYUFSSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  1  0  0  0  0  0999 V2000
    4.3821    4.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7397    2.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2033    2.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6503    1.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8212    0.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6339    0.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1703    0.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1510   -0.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5245    2.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2987    3.5008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4702    4.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5880    4.0025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444    5.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4139    6.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1852    8.3446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7870    8.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6041   10.0737    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.6175    7.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4990    8.3831    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.8462    6.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2707   -2.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7233    1.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  2  0
 24 17  1  0
 12 25  1  0
 25 26  1  0
 26 27  1  1
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 29  1  0
 26 35  1  0
 35  9  1  0
 35 36  2  0
  7 37  1  0
 37  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3986734

    ---

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 551.60Molecular Weight (Monoisotopic): 550.2841AlogP: 5.23#Rotatable Bonds: 8
Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.03CX LogP: 4.79CX LogD: 3.15
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: -0.68

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):