The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 403 ID: ALA3986734
PubChem CID: 127054208
Max Phase: Preclinical
Molecular Formula: C29H44Cl2N4O2
Molecular Weight: 551.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1CC(C)CC(CN2CC[C@H](CNC(=O)c3ccc(Cl)c(Cl)c3)N[C@H](CCN3CCCCC3)C2=O)C1
Standard InChI: InChI=1S/C29H44Cl2N4O2/c1-20-14-21(2)16-22(15-20)19-35-13-8-24(18-32-28(36)23-6-7-25(30)26(31)17-23)33-27(29(35)37)9-12-34-10-4-3-5-11-34/h6-7,17,20-22,24,27,33H,3-5,8-16,18-19H2,1-2H3,(H,32,36)/t20?,21?,22?,24-,27-/m1/s1
Standard InChI Key: JHFWVCSWKAZHNG-VJUIYUFSSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
4.3821 4.0660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7397 2.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2033 2.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6503 1.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8212 0.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6339 0.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1703 0.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1510 -0.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 2.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2987 3.5008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4702 4.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5880 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2444 5.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4139 6.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1852 8.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7870 8.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6041 10.0737 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.6175 7.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4990 8.3831 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.8462 6.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4048 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5555 -4.3709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0513 -4.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7022 -5.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8572 -7.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3614 -6.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7106 -5.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2707 -2.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7233 1.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 1 0
22 24 2 0
24 17 1 0
12 25 1 0
25 26 1 0
26 27 1 1
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 29 1 0
26 35 1 0
35 9 1 0
35 36 2 0
7 37 1 0
37 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.60Molecular Weight (Monoisotopic): 550.2841AlogP: 5.23#Rotatable Bonds: 8Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.03CX LogP: 4.79CX LogD: 3.15Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: -0.68
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,