The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 364 ID: ALA3986770
PubChem CID: 46897054
Max Phase: Preclinical
Molecular Formula: C21H22Cl4N4O2
Molecular Weight: 504.25
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC[C@@H]1N[C@H](CNC(=O)c2ccc(Cl)c(Cl)c2)CCN(Cc2cc(Cl)cc(Cl)c2)C1=O
Standard InChI: InChI=1S/C21H22Cl4N4O2/c22-14-5-12(6-15(23)8-14)11-29-4-3-16(28-19(9-26)21(29)31)10-27-20(30)13-1-2-17(24)18(25)7-13/h1-2,5-8,16,19,28H,3-4,9-11,26H2,(H,27,30)/t16-,19-/m0/s1
Standard InChI Key: PCFLAUAVIGOSHR-LPHOPBHVSA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
3.9660 0.1648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1510 -0.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0030 3.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.9799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3069 5.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2687 6.0825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6077 6.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6130 7.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9146 8.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2110 7.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2523 8.3168 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.2059 6.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2430 5.6169 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9043 5.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4048 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5571 -4.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0533 -4.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5777 -5.5556 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.8940 -3.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2386 -1.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9111 -0.8909 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.7424 -1.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2707 -2.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 1
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
13 15 1 0
15 16 1 0
15 17 2 0
17 10 1 0
5 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
27 28 1 0
27 29 2 0
29 22 1 0
20 30 1 0
30 3 1 0
30 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.25Molecular Weight (Monoisotopic): 502.0497AlogP: 3.75#Rotatable Bonds: 6Polar Surface Area: 87.46Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.32CX LogP: 3.31CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -0.94
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,