US9328118, 108

ID: ALA3986814

PubChem CID: 117914070

Max Phase: Preclinical

Molecular Formula: C28H32F3N5O3

Molecular Weight: 543.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1nc(-c2ccc(OCCC3CCN(CCO)CC3)c(C(F)(F)F)c2)c2ccn(CC3CCCO3)c2n1

Standard InChI:  InChI=1S/C28H32F3N5O3/c29-28(30,31)23-16-20(3-4-24(23)39-15-8-19-5-9-35(10-6-19)12-13-37)26-22-7-11-36(18-21-2-1-14-38-21)27(22)34-25(17-32)33-26/h3-4,7,11,16,19,21,37H,1-2,5-6,8-10,12-15,18H2

Standard InChI Key:  XTHNVRPOPJQNJG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   15.3185    1.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2817    0.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2866   -0.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9898   -1.4988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9926   -2.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6950   -3.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3945   -3.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0946   -3.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945   -3.0041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4946   -3.7543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8919   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8521   -5.8523    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9304   -5.8546    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8906   -6.4533    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8823   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3600   -2.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9656   -3.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8476   -4.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5510   -4.0107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3918   -1.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6894   -0.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
 14 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 23 36  1  0
 36 37  3  0
  7 38  1  0
 38 39  1  0
 39  4  1  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.59Molecular Weight (Monoisotopic): 543.2457AlogP: 4.64#Rotatable Bonds: 9
Polar Surface Area: 96.43Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.05CX LogP: 4.46CX LogD: 2.81
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.42Np Likeness Score: -1.06

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):