The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 478 ID: ALA3986831
PubChem CID: 127054280
Max Phase: Preclinical
Molecular Formula: C31H40Cl2N4O4
Molecular Weight: 603.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](CN1CC[C@H](CNC(=O)c2ccc(Cl)c(Cl)c2)N[C@H](CCN2CCC(C(=O)O)CC2)C1=O)c1ccccc1
Standard InChI: InChI=1S/C31H40Cl2N4O4/c1-2-21(22-6-4-3-5-7-22)20-37-17-12-25(19-34-29(38)24-8-9-26(32)27(33)18-24)35-28(30(37)39)13-16-36-14-10-23(11-15-36)31(40)41/h3-9,18,21,23,25,28,35H,2,10-17,19-20H2,1H3,(H,34,38)(H,40,41)/t21-,25-,28-/m1/s1
Standard InChI Key: LBTPHRXHXMLVPM-LFGPKHSOSA-N
Molfile:
RDKit 2D
41 44 0 0 1 0 0 0 0 0999 V2000
2.5517 2.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7225 1.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1703 0.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1510 -0.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 2.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2987 3.5008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4702 4.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5880 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2444 5.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4139 6.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1852 8.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7870 8.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6041 10.0737 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.6175 7.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4990 8.3831 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.8462 6.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4048 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5555 -4.3709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0513 -4.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7022 -5.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8572 -7.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3614 -6.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7106 -5.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5056 -8.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8282 -9.4180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7021 -8.5192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2707 -2.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6342 0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6545 1.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1169 0.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5590 -0.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -1.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0764 -1.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 1
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 1 0
18 20 2 0
20 13 1 0
8 21 1 0
21 22 1 0
22 23 1 1
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 25 1 0
28 31 1 0
31 32 2 0
31 33 1 0
22 34 1 0
34 5 1 0
34 35 2 0
3 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.59Molecular Weight (Monoisotopic): 602.2427AlogP: 4.66#Rotatable Bonds: 11Polar Surface Area: 101.98Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.71CX Basic pKa: 9.20CX LogP: 1.40CX LogD: 1.41Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.35Np Likeness Score: -0.63
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,